CAS 1260751-56-1 is the registry number for 3-(Azetidin-3-yl)-2,6-dichloropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(azetidin-3-yl)-2,6-dichloropyridine (CAS 1260751-56-1) is a chemical compound with the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. IUPAC name: 3-(azetidin-3-yl)-2,6-dichloropyridine. InChIKey: GBUQHKAMEGDAHE-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N2 |
|---|---|
| Molecular weight | 203.07 g/mol |
| IUPAC name | 3-(azetidin-3-yl)-2,6-dichloropyridine |
| InChIKey | GBUQHKAMEGDAHE-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=C(N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)