Products 1260770-02-2

CAS 1260770-02-2 is the registry number for 4-Acetyl-5-bromonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-acetyl-5-bromopyridine-3-carboxylic acid (CAS 1260770-02-2) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 4-acetyl-5-bromopyridine-3-carboxylic acid. InChIKey: BEPIPEQGMIZSET-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrNO3
Molecular weight244.04 g/mol
IUPAC name4-acetyl-5-bromopyridine-3-carboxylic acid
InChIKeyBEPIPEQGMIZSET-UHFFFAOYSA-N
SMILESCC(=O)C1=C(C=NC=C1C(=O)O)Br

Computed by PubChem (NCBI)