CAS 6851-99-6 appears in our catalog under these names: Bromo-2’-nitroacetophenone, 2–Bromo–2′–nitroacetophenone, 2-Bromo-2'-nitroacetophenone, 98% , 2-Bromo-2'-nitroacetophenone, 98%, 2-Bromo-2'-nitroacetophenone, >98.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: 1g, 2,5g, 5g, 100g, 25g, 10g.
2-bromo-1-(2-nitrophenyl)ethanone (CAS 6851-99-6) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-bromo-1-(2-nitrophenyl)ethanone. InChIKey: SGXUUCSRVVSMGK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-bromo-1-(2-nitrophenyl)ethanone |
| InChIKey | SGXUUCSRVVSMGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)