CAS 1211597-12-4 appears in our catalog under these names: 7-Bromo-2,3-dihydrobenzo[d]oxazole-2-carboxylic acid, 95%, 7-Bromo-2,3-dihydrobenzo(d)oxazole-2-carboxylic acid, 95+%, 7-Bromo-2,3-dihydro-benzofuran-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
7-bromo-2,3-dihydro-1,3-benzoxazole-2-carboxylic acid (CAS 1211597-12-4) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1,3-benzoxazole-2-carboxylic acid. InChIKey: BLPKVWYMVJLHDW-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1,3-benzoxazole-2-carboxylic acid |
| InChIKey | BLPKVWYMVJLHDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC(N2)C(=O)O |
Computed by PubChem (NCBI)