CAS 82463-74-9 is the registry number for 6-Bromo-1,3-benzodioxole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-bromo-1,3-benzodioxole-5-carboxamide (CAS 82463-74-9) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 6-bromo-1,3-benzodioxole-5-carboxamide. InChIKey: XAJNDBMJYKWZRH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxole-5-carboxamide |
| InChIKey | XAJNDBMJYKWZRH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)N)Br |
Computed by PubChem (NCBI)