CAS 18640-58-9 appears in our catalog under these names: 4'-Bromo-3'-nitroacetophenone, 98%, 4'–Bromo–3'–nitroacetophenone, 4'-Bromo-3'-nitroacetophenone, 99% , 4-Bromo-3-nitroacetophenone - 90%, 4-Bromo-3-nitroacetophenone. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 250g, 50g, 500g, 1000g.
1-(4-bromo-3-nitrophenyl)ethanone (CAS 18640-58-9) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)ethanone. InChIKey: YFVOFFKNHQTQQE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)ethanone |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)