CAS 1260777-93-2 appears in our catalog under these names: Methyl 2-cyano-5-nitrobenzoate, 97%, Methyl 2-Cyano-5-Nitrobenzoate, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-cyano-5-nitrobenzoate (CAS 1260777-93-2) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: methyl 2-cyano-5-nitrobenzoate. InChIKey: VWINUIIJHHBLKR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | methyl 2-cyano-5-nitrobenzoate |
| InChIKey | VWINUIIJHHBLKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)