CAS 1260783-59-2 is the registry number for N-Methyl-1-(3-pyridinyl)ethanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
N-methyl-1-pyridin-3-ylethanamine;oxalic acid (CAS 1260783-59-2) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: N-methyl-1-pyridin-3-ylethanamine;oxalic acid. InChIKey: UUWXRUSNBOWTQK-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | N-methyl-1-pyridin-3-ylethanamine;oxalic acid |
| InChIKey | UUWXRUSNBOWTQK-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=CC=C1)NC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)