Products 1820607-83-7
CAS 1820607-83-7 is the registry number for 1-tert-Butyl 3-methyl pyrazole-1,3-dicarboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-O-tert-butyl 3-O-methyl pyrazole-1,3-dicarboxylate (CAS 1820607-83-7) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl pyrazole-1,3-dicarboxylate. InChIKey: BVQUOORGRDGCMX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl pyrazole-1,3-dicarboxylate |
| InChIKey | BVQUOORGRDGCMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC(=N1)C(=O)OC |
Computed by PubChem (NCBI)