CAS 610255-36-2 appears in our catalog under these names: N'-Hydroxy-3,4,5-trimethoxybenzene-1-carboximidamide, 95%, N'-Hydroxy-3,4,5-trimethoxybenzene-1-carboximidamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
N'-hydroxy-3,4,5-trimethoxybenzenecarboximidamide (CAS 610255-36-2) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: N'-hydroxy-3,4,5-trimethoxybenzenecarboximidamide. InChIKey: WNBVDBVAKULULZ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | N'-hydroxy-3,4,5-trimethoxybenzenecarboximidamide |
| InChIKey | WNBVDBVAKULULZ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C(=N/O)/N |
Computed by PubChem (NCBI)