CAS 55100-59-9 appears in our catalog under these names: 1,3-Dinitroadamantane, 95%, 1,3-Dinitroadamantane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
1,3-dinitroadamantane (CAS 55100-59-9) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 1,3-dinitroadamantane. InChIKey: USKZHFZEQOROEM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 1,3-dinitroadamantane |
| InChIKey | USKZHFZEQOROEM-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)