Products 1260790-63-3
CAS 1260790-63-3 appears in our catalog under these names: 1–(4–bromo–2–chlorophenyl)cyclopropan–1–amine hydrochloride, 1-(4-Bromo-2-chlorophenyl)cyclopropan-1-amine, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
1-(4-bromo-2-chlorophenyl)cyclopropan-1-amine (CAS 1260790-63-3) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)cyclopropan-1-amine. InChIKey: NDHYCJVIKNXBMK-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)cyclopropan-1-amine |
| InChIKey | NDHYCJVIKNXBMK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Br)Cl)N |
Computed by PubChem (NCBI)