CAS 1260795-43-4 appears in our catalog under these names: 2–methyl–2–(4–(trifluoromethoxy)phenyl)propanoic acid, 2-Methyl-2-(4-(trifluoromethoxy)phenyl)propanoic acid, 2-methyl-2-[4-(trifluoromethoxy)phenyl]propanoic acid, 2-Methyl-2-(4-(trifluoromethoxy)phenyl)propanoic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, AmBeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg.
2-methyl-2-[4-(trifluoromethoxy)phenyl]propanoic acid (CAS 1260795-43-4) is a chemical compound with the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. IUPAC name: 2-methyl-2-[4-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: FOPARMLTSFOAEO-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O3 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 2-methyl-2-[4-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | FOPARMLTSFOAEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)