CAS 1260795-87-6 appears in our catalog under these names: 2-(4-Amino-2-chlorophenyl)acetic acid, 95%, 2–(4–Amino–2–chlorophenyl)acetic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-(4-amino-2-chlorophenyl)acetic acid (CAS 1260795-87-6) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-(4-amino-2-chlorophenyl)acetic acid. InChIKey: LZFJFQHEDTXZDG-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-(4-amino-2-chlorophenyl)acetic acid |
| InChIKey | LZFJFQHEDTXZDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)CC(=O)O |
Computed by PubChem (NCBI)