Products 1260809-99-1
CAS 1260809-99-1 is the registry number for Methyl 3-chloro-4-(hydroxymethyl)benzoate, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-chloro-4-(hydroxymethyl)benzoate (CAS 1260809-99-1) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 3-chloro-4-(hydroxymethyl)benzoate. InChIKey: IVPABLVPRNGYTA-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 3-chloro-4-(hydroxymethyl)benzoate |
| InChIKey | IVPABLVPRNGYTA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CO)Cl |
Computed by PubChem (NCBI)