Products 1260844-01-6
CAS 1260844-01-6 is the registry number for 5-Bromo-6-(trifluoromethyl)pyrimidin-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-6-(trifluoromethyl)pyrimidin-4-amine (CAS 1260844-01-6) is a chemical compound with the molecular formula C5H3BrF3N3 and a molecular weight of 242.00 g/mol. IUPAC name: 5-bromo-6-(trifluoromethyl)pyrimidin-4-amine. InChIKey: RYPIPAUETYMWCO-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3N3 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethyl)pyrimidin-4-amine |
| InChIKey | RYPIPAUETYMWCO-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(C(=N1)N)Br)C(F)(F)F |
Computed by PubChem (NCBI)