Products 1378259-23-4
CAS 1378259-23-4 appears in our catalog under these names: 6–Bromo–2–(trifluoromethyl)pyrimidin–4–amine, 6-Bromo-2-(trifluoromethyl)pyrimidin-4-amine, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-2-(trifluoromethyl)pyrimidin-4-amine (CAS 1378259-23-4) is a chemical compound with the molecular formula C5H3BrF3N3 and a molecular weight of 242.00 g/mol. IUPAC name: 6-bromo-2-(trifluoromethyl)pyrimidin-4-amine. InChIKey: ZTGDYALJMNYCDG-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3N3 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 6-bromo-2-(trifluoromethyl)pyrimidin-4-amine |
| InChIKey | ZTGDYALJMNYCDG-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Br)C(F)(F)F)N |
Computed by PubChem (NCBI)