CAS 1522164-62-0 is the registry number for 4-Bromo-6-(trifluoromethyl)pyrimidin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-(trifluoromethyl)pyrimidin-2-amine (CAS 1522164-62-0) is a chemical compound with the molecular formula C5H3BrF3N3 and a molecular weight of 242.00 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)pyrimidin-2-amine. InChIKey: ZXKFBQZJLGKMEX-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3N3 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethyl)pyrimidin-2-amine |
| InChIKey | ZXKFBQZJLGKMEX-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Br)N)C(F)(F)F |
Computed by PubChem (NCBI)