CAS 1310918-29-6 appears in our catalog under these names: 4-Bromo-6-(trifluoromethyl)pyridazin-3-amine, 4-Bromo-6-(trifluoromethyl)pyridazin-3-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g, 5g.
4-bromo-6-(trifluoromethyl)pyridazin-3-amine (CAS 1310918-29-6) is a chemical compound with the molecular formula C5H3BrF3N3 and a molecular weight of 242.00 g/mol. IUPAC name: 4-bromo-6-(trifluoromethyl)pyridazin-3-amine. InChIKey: PIZSHCRWJOXLFZ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrF3N3 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethyl)pyridazin-3-amine |
| InChIKey | PIZSHCRWJOXLFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1C(F)(F)F)N)Br |
Computed by PubChem (NCBI)