Products 1260899-55-5
CAS 1260899-55-5 is the registry number for 2-Amino-1-(4-methoxy-2-methylphenyl)-1H-indole-3-carbonitrile, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-amino-1-(4-methoxy-2-methylphenyl)indole-3-carbonitrile (CAS 1260899-55-5) is a chemical compound with the molecular formula C17H15N3O and a molecular weight of 277.32 g/mol. IUPAC name: 2-amino-1-(4-methoxy-2-methylphenyl)indole-3-carbonitrile. InChIKey: DWQIWKOACUNZRR-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 2-amino-1-(4-methoxy-2-methylphenyl)indole-3-carbonitrile |
| InChIKey | DWQIWKOACUNZRR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)N2C3=CC=CC=C3C(=C2N)C#N |
Computed by PubChem (NCBI)