Products 1260955-10-9
CAS 1260955-10-9 is the registry number for 1-(4-(Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine (CAS 1260955-10-9) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine. InChIKey: WOWCIGGGXSUZIG-UHFFFAOYSA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine |
| InChIKey | WOWCIGGGXSUZIG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(C)N |
Computed by PubChem (NCBI)