Products 1260955-12-1
CAS 1260955-12-1 is the registry number for (1S)-1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethan-1-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine (CAS 1260955-12-1) is a chemical compound with the molecular formula C14H22BNO2 and a molecular weight of 247.14 g/mol. IUPAC name: (1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine. InChIKey: WOWCIGGGXSUZIG-JTQLQIEISA-N.
| Molecular formula | C14H22BNO2 |
|---|---|
| Molecular weight | 247.14 g/mol |
| IUPAC name | (1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanamine |
| InChIKey | WOWCIGGGXSUZIG-JTQLQIEISA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)[C@H](C)N |
Computed by PubChem (NCBI)