CAS 1261024-30-9 is the registry number for N-Hydroxy-2-(2,4,5-trifluorophenyl)acetimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-hydroxy-2-(2,4,5-trifluorophenyl)ethanimidamide (CAS 1261024-30-9) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: N'-hydroxy-2-(2,4,5-trifluorophenyl)ethanimidamide. InChIKey: RKYRWQVUCQTALX-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | N'-hydroxy-2-(2,4,5-trifluorophenyl)ethanimidamide |
| InChIKey | RKYRWQVUCQTALX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C/C(=N/O)/N |
Computed by PubChem (NCBI)