CAS 40067-66-1 is the registry number for 2-(Trifluoromethyl)benzamidoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide (CAS 40067-66-1) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide. InChIKey: PVKWCVFBDWTUAU-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | N'-hydroxy-2-(trifluoromethyl)benzenecarboximidamide |
| InChIKey | PVKWCVFBDWTUAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=NO)N)C(F)(F)F |
Computed by PubChem (NCBI)