CAS 22227-25-4 appears in our catalog under these names: 3-(Trifluoromethyl)benzohydrazide, 97%, 3-(Trifluoromethyl)Benzohydrazide, 97%, 97%, 3-(Trifluoromethyl)benzoic acid hydrazide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
3-(trifluoromethyl)benzohydrazide (CAS 22227-25-4) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: 3-(trifluoromethyl)benzohydrazide. InChIKey: HGUSYNBASYGAMC-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzohydrazide |
| InChIKey | HGUSYNBASYGAMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)NN |
Computed by PubChem (NCBI)