CAS 934600-95-0 appears in our catalog under these names: 4-Amino-2-(trifluoromethyl)benzamide, 97%, Enzalutamide Impurity 34, 4–Amino–2–(trifluoromethyl)benzamide. Offered by: Combi-blocks, Chemat Brand, GLPBio. Available pack sizes: 1g, 10g, 25g, 250mg, 5g, on request, 100mg.
4-amino-2-(trifluoromethyl)benzamide (CAS 934600-95-0) is a chemical compound with the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. IUPAC name: 4-amino-2-(trifluoromethyl)benzamide. InChIKey: SFCGTQFWCJKPMA-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 4-amino-2-(trifluoromethyl)benzamide |
| InChIKey | SFCGTQFWCJKPMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)C(=O)N |
Computed by PubChem (NCBI)