CAS 1261238-06-5 appears in our catalog under these names: Pantoprazole Impurity 47, 2-(((3,4-Dimethoxypyridin-2-yl)methyl)sulfinyl)-1H-benzo[d]imidazol-6-ol, 98%, Pantoprazole Impurity 33, Desdifluoromethoxy Hydroxy Pantoprazole. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-ol (CAS 1261238-06-5) is a chemical compound with the molecular formula C15H15N3O4S and a molecular weight of 333.4 g/mol. IUPAC name: 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-ol. InChIKey: JDTUAEPGGXGQMA-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 2-[(3,4-dimethoxy-2-pyridinyl)methylsulfinyl]-3H-benzimidazol-5-ol |
| InChIKey | JDTUAEPGGXGQMA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)O)OC |
Computed by PubChem (NCBI)