CAS 1596379-07-5 appears in our catalog under these names: Hydroxy Fenbendazole-d3, D3-Hydroxyfenbendazole hydrate. Offered by: Chemat Brand, HPC Standards. Available pack sizes: on request, 1x10mg.
Trideuteriomethyl N-[6-(4-hydroxyphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate;hydrate (CAS 1596379-07-5) is a chemical compound with the molecular formula C15H15N3O4S and a molecular weight of 336.4 g/mol. IUPAC name: trideuteriomethyl N-[6-(4-hydroxyphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate;hydrate. InChIKey: JFFKWYDCSIKODM-NIIDSAIPSA-N.
| Molecular formula | C15H15N3O4S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | trideuteriomethyl N-[6-(4-hydroxyphenyl)sulfanyl-1H-benzimidazol-2-yl]carbamate;hydrate |
| InChIKey | JFFKWYDCSIKODM-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)NC1=NC2=C(N1)C=C(C=C2)SC3=CC=C(C=C3)O.O |
Computed by PubChem (NCBI)