CAS 361371-27-9 appears in our catalog under these names: 1-[4-(3-Nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid, 95%, 1-(4-(3-Nitrophenyl)thiazol-2-yl)piperidine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g, 5g.
1-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid (CAS 361371-27-9) is a chemical compound with the molecular formula C15H15N3O4S and a molecular weight of 333.4 g/mol. IUPAC name: 1-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid. InChIKey: OJPQBEOHCXLKHL-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 1-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
| InChIKey | OJPQBEOHCXLKHL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC(=CS2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)