CAS 143957-12-4 appears in our catalog under these names: O-Benzoyllamivudine, >95% (HPLC), O-Benzoyllamivudine. Offered by: TRC, Mikromol. Available pack sizes: 100mg, 250mg, 25mg.
[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate (CAS 143957-12-4) is a chemical compound with the molecular formula C15H15N3O4S and a molecular weight of 333.4 g/mol. IUPAC name: [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate. InChIKey: SWOOIHFMFZUHOC-QWHCGFSZSA-N.
| Molecular formula | C15H15N3O4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl benzoate |
| InChIKey | SWOOIHFMFZUHOC-QWHCGFSZSA-N |
| SMILES | C1[C@H](O[C@H](S1)COC(=O)C2=CC=CC=C2)N3C=CC(=NC3=O)N |
Computed by PubChem (NCBI)