CAS 1261365-46-1 is the registry number for N-(3-Formyl-5-(trifluoromethyl)pyridin-2-yl)-pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
N-[3-formyl-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide (CAS 1261365-46-1) is a chemical compound with the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. IUPAC name: N-[3-formyl-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide. InChIKey: AJHPFYORBMFGTP-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O2 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | N-[3-formyl-5-(trifluoromethyl)-2-pyridinyl]-2,2-dimethylpropanamide |
| InChIKey | AJHPFYORBMFGTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)