CAS 1803595-02-9 appears in our catalog under these names: 2,2-Dimethyl-N-(4-(trifluoroacetyl)pyridin-3-yl)propanamide, 95%, 2,2-Dimethyl-N-(4-(trifluoroacetyl)pyridin-3-yl)propanamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,2-dimethyl-N-[4-(2,2,2-trifluoroacetyl)-3-pyridinyl]propanamide (CAS 1803595-02-9) is a chemical compound with the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. IUPAC name: 2,2-dimethyl-N-[4-(2,2,2-trifluoroacetyl)-3-pyridinyl]propanamide. InChIKey: UMXFGXTWUSEXFT-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O2 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | 2,2-dimethyl-N-[4-(2,2,2-trifluoroacetyl)-3-pyridinyl]propanamide |
| InChIKey | UMXFGXTWUSEXFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CN=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)