Products 812643-49-5
CAS 812643-49-5 is the registry number for 2,3,5-Trifluoro-4-(4-methylpiperazin-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 812643-49-5) is a chemical compound with the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. IUPAC name: 2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: LGPZFOWYMRRNOM-UHFFFAOYSA-N.
| Molecular formula | C12H13F3N2O2 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | 2,3,5-trifluoro-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | LGPZFOWYMRRNOM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C(=C2F)F)C(=O)O)F |
Computed by PubChem (NCBI)