CAS 477862-20-7 is the registry number for (Z)-(Ethyl n-[(z)-4-(trifluoromethyl)benzoyl]ethanecarbohydrazonate), 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl (1Z)-N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate (CAS 477862-20-7) is a chemical compound with the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. IUPAC name: ethyl (1Z)-N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate. InChIKey: GPERAPHAUXRALL-PXNMLYILSA-N.
| Molecular formula | C12H13F3N2O2 |
|---|---|
| Molecular weight | 274.24 g/mol |
| IUPAC name | ethyl (1Z)-N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate |
| InChIKey | GPERAPHAUXRALL-PXNMLYILSA-N |
| SMILES | CCO/C(=N\NC(=O)C1=CC=C(C=C1)C(F)(F)F)/C |
Computed by PubChem (NCBI)