CAS 1261365-54-1 appears in our catalog under these names: (1,5-Naphthyridin-3-yl)methanol, 95%, (1,5-Naphthyridin-3-yl)methanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
1,5-naphthyridin-3-ylmethanol (CAS 1261365-54-1) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 1,5-naphthyridin-3-ylmethanol. InChIKey: FONKMHAKOWUIOL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 1,5-naphthyridin-3-ylmethanol |
| InChIKey | FONKMHAKOWUIOL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)CO)N=C1 |
Computed by PubChem (NCBI)