CAS 1261393-71-8 appears in our catalog under these names: Diclofenac-13C6, >95% (HPLC), Diclofenac-13C6 (may contain up to 3% unlabelled), >95% (HPLC), Diclofenac–13C6, Diclofenac-13C6, 99.90%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 1 mg.
2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid (CAS 1261393-71-8) is a chemical compound with the molecular formula C14H11Cl2NO2 and a molecular weight of 302.10 g/mol. IUPAC name: 2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid. InChIKey: DCOPUUMXTXDBNB-PWMXWAJOSA-N.
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 2-[6-(2,6-dichloroanilino)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]acetic acid |
| InChIKey | DCOPUUMXTXDBNB-PWMXWAJOSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2CC(=O)O)Cl |
Computed by PubChem (NCBI)