Products 218457-10-4
CAS 218457-10-4 is the registry number for N-(5-Chloro-2-hydroxyphenyl)-2-(chloromethyl)benzamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-chloro-2-hydroxyphenyl)-2-(chloromethyl)benzamide (CAS 218457-10-4) is a chemical compound with the molecular formula C14H11Cl2NO2 and a molecular weight of 296.1 g/mol. IUPAC name: N-(5-chloro-2-hydroxyphenyl)-2-(chloromethyl)benzamide. InChIKey: RJLDFNIDYBRLQN-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 296.1 g/mol |
| IUPAC name | N-(5-chloro-2-hydroxyphenyl)-2-(chloromethyl)benzamide |
| InChIKey | RJLDFNIDYBRLQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)C(=O)NC2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)