Products 1261393-89-8
CAS 1261393-89-8 is the registry number for N,O-Didesmethyl Tramadol-d3 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol;hydrochloride (CAS 1261393-89-8) is a chemical compound with the molecular formula C14H22ClNO2 and a molecular weight of 274.80 g/mol. IUPAC name: 3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol;hydrochloride. InChIKey: SEBJHQKEHXABPM-FTKSRVEOSA-N.
| Molecular formula | C14H22ClNO2 |
|---|---|
| Molecular weight | 274.80 g/mol |
| IUPAC name | 3-[(1R,2R)-1-hydroxy-2-[(trideuteriomethylamino)methyl]cyclohexyl]phenol;hydrochloride |
| InChIKey | SEBJHQKEHXABPM-FTKSRVEOSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O.Cl |
Computed by PubChem (NCBI)