CAS 333364-41-3 is the registry number for rac N,O-Didesmethyl Tramadol Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3-[(1R,2R)-1-hydroxy-2-(methylaminomethyl)cyclohexyl]phenol;hydrochloride (CAS 333364-41-3) is a chemical compound with the molecular formula C14H22ClNO2 and a molecular weight of 271.78 g/mol. IUPAC name: 3-[(1R,2R)-1-hydroxy-2-(methylaminomethyl)cyclohexyl]phenol;hydrochloride. InChIKey: SEBJHQKEHXABPM-OJMBIDBESA-N.
| Molecular formula | C14H22ClNO2 |
|---|---|
| Molecular weight | 271.78 g/mol |
| IUPAC name | 3-[(1R,2R)-1-hydroxy-2-(methylaminomethyl)cyclohexyl]phenol;hydrochloride |
| InChIKey | SEBJHQKEHXABPM-OJMBIDBESA-N |
| SMILES | CNC[C@H]1CCCC[C@@]1(C2=CC(=CC=C2)O)O.Cl |
Computed by PubChem (NCBI)