Products 1261448-01-4
CAS 1261448-01-4 is the registry number for 2-Bromo-1-(bromomethyl)-4-(difluoromethyl)benzene, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg.
2-bromo-1-(bromomethyl)-4-(difluoromethyl)benzene (CAS 1261448-01-4) is a chemical compound with the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. IUPAC name: 2-bromo-1-(bromomethyl)-4-(difluoromethyl)benzene. InChIKey: QDUVBHRJRAVMMR-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2 |
|---|---|
| Molecular weight | 299.94 g/mol |
| IUPAC name | 2-bromo-1-(bromomethyl)-4-(difluoromethyl)benzene |
| InChIKey | QDUVBHRJRAVMMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)F)Br)CBr |
Computed by PubChem (NCBI)