CAS 1261476-45-2 is the registry number for 3-Bromo-5-(difluoromethyl)benzyl bromide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-3-(bromomethyl)-5-(difluoromethyl)benzene (CAS 1261476-45-2) is a chemical compound with the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. IUPAC name: 1-bromo-3-(bromomethyl)-5-(difluoromethyl)benzene. InChIKey: CTCULAYIHDSLFE-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2 |
|---|---|
| Molecular weight | 299.94 g/mol |
| IUPAC name | 1-bromo-3-(bromomethyl)-5-(difluoromethyl)benzene |
| InChIKey | CTCULAYIHDSLFE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)F)Br)CBr |
Computed by PubChem (NCBI)