CAS 1261791-24-5 appears in our catalog under these names: 2-Bromo-6-(difluoromethyl)benzyl bromide, 95%, 1–Bromo–2–(bromomethyl)–3–(difluoromethyl)benzene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
1-bromo-2-(bromomethyl)-3-(difluoromethyl)benzene (CAS 1261791-24-5) is a chemical compound with the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-3-(difluoromethyl)benzene. InChIKey: WZMMEBJQPPDAQJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2 |
|---|---|
| Molecular weight | 299.94 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-3-(difluoromethyl)benzene |
| InChIKey | WZMMEBJQPPDAQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CBr)C(F)F |
Computed by PubChem (NCBI)