CAS 2648588-65-0 is the registry number for 1,3-Dibromo-5-(1,1-difluoroethyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dibromo-5-(1,1-difluoroethyl)benzene (CAS 2648588-65-0) is a chemical compound with the molecular formula C8H6Br2F2 and a molecular weight of 299.94 g/mol. IUPAC name: 1,3-dibromo-5-(1,1-difluoroethyl)benzene. InChIKey: DYBGUYKEXAGFQC-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2F2 |
|---|---|
| Molecular weight | 299.94 g/mol |
| IUPAC name | 1,3-dibromo-5-(1,1-difluoroethyl)benzene |
| InChIKey | DYBGUYKEXAGFQC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Br)Br)(F)F |
Computed by PubChem (NCBI)