CAS 1261476-32-7 is the registry number for Phenylephrine Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(3-chloro-5-hydroxyphenyl)ethanone (CAS 1261476-32-7) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-chloro-1-(3-chloro-5-hydroxyphenyl)ethanone. InChIKey: WYKMVSLPRBIBRO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-chloro-1-(3-chloro-5-hydroxyphenyl)ethanone |
| InChIKey | WYKMVSLPRBIBRO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)Cl)C(=O)CCl |
Computed by PubChem (NCBI)