Products 1261499-12-0
CAS 1261499-12-0 appears in our catalog under these names: 2-Bromo-3-chlorobenzene-1-sulfonamide, 95%, 2-Bromo-3-chlorobenzene-1-sulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2-bromo-3-chlorobenzenesulfonamide (CAS 1261499-12-0) is a chemical compound with the molecular formula C6H5BrClNO2S and a molecular weight of 270.53 g/mol. IUPAC name: 2-bromo-3-chlorobenzenesulfonamide. InChIKey: YBHUUFHJQXIXRI-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2S |
|---|---|
| Molecular weight | 270.53 g/mol |
| IUPAC name | 2-bromo-3-chlorobenzenesulfonamide |
| InChIKey | YBHUUFHJQXIXRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Br)S(=O)(=O)N |
Computed by PubChem (NCBI)