CAS 1261678-72-1 appears in our catalog under these names: 3-Bromo-2-chlorobenzene-1-sulfonamide, 3-Bromo-2-chlorobenzene-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-bromo-2-chlorobenzenesulfonamide (CAS 1261678-72-1) is a chemical compound with the molecular formula C6H5BrClNO2S and a molecular weight of 270.53 g/mol. IUPAC name: 3-bromo-2-chlorobenzenesulfonamide. InChIKey: BRRMHBQHBVWTGW-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2S |
|---|---|
| Molecular weight | 270.53 g/mol |
| IUPAC name | 3-bromo-2-chlorobenzenesulfonamide |
| InChIKey | BRRMHBQHBVWTGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)