CAS 351003-59-3 appears in our catalog under these names: 4-Bromo-2-chlorobenzenesulfonamide, 97%, 4–Bromo–2–Chlorobenzenesulfonamide, 4-Bromo-2-chlorobenzenesulfonamide, 99%(LC-MS),RG. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 5g.
4-bromo-2-chlorobenzenesulfonamide (CAS 351003-59-3) is a chemical compound with the molecular formula C6H5BrClNO2S and a molecular weight of 270.53 g/mol. IUPAC name: 4-bromo-2-chlorobenzenesulfonamide. InChIKey: BFZLQNCZBMUSRS-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2S |
|---|---|
| Molecular weight | 270.53 g/mol |
| IUPAC name | 4-bromo-2-chlorobenzenesulfonamide |
| InChIKey | BFZLQNCZBMUSRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)