Products 1393582-71-2
CAS 1393582-71-2 is the registry number for 6-Bromo-4-methylpyridine-2-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-methylpyridine-2-sulfonyl chloride (CAS 1393582-71-2) is a chemical compound with the molecular formula C6H5BrClNO2S and a molecular weight of 270.53 g/mol. IUPAC name: 6-bromo-4-methylpyridine-2-sulfonyl chloride. InChIKey: GZPJJPBNTXAUIB-UHFFFAOYSA-N.
| Molecular formula | C6H5BrClNO2S |
|---|---|
| Molecular weight | 270.53 g/mol |
| IUPAC name | 6-bromo-4-methylpyridine-2-sulfonyl chloride |
| InChIKey | GZPJJPBNTXAUIB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)