CAS 1261552-41-3 appears in our catalog under these names: 5-Bromo-2-(difluoromethoxy)nitrobenzene, 95%, 4-Bromo-1-(difluoromethoxy)-2-nitrobenzene, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-1-(difluoromethoxy)-2-nitrobenzene (CAS 1261552-41-3) is a chemical compound with the molecular formula C7H4BrF2NO3 and a molecular weight of 268.01 g/mol. IUPAC name: 4-bromo-1-(difluoromethoxy)-2-nitrobenzene. InChIKey: OGNULTMJFVFEMD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO3 |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 4-bromo-1-(difluoromethoxy)-2-nitrobenzene |
| InChIKey | OGNULTMJFVFEMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])OC(F)F |
Computed by PubChem (NCBI)