Products 2559710-44-8
CAS 2559710-44-8 is the registry number for 5-Bromo-2-(difluoromethoxy)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(difluoromethoxy)pyridine-3-carboxylic acid (CAS 2559710-44-8) is a chemical compound with the molecular formula C7H4BrF2NO3 and a molecular weight of 268.01 g/mol. IUPAC name: 5-bromo-2-(difluoromethoxy)pyridine-3-carboxylic acid. InChIKey: YXIICHHPOLDKMW-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO3 |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethoxy)pyridine-3-carboxylic acid |
| InChIKey | YXIICHHPOLDKMW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)OC(F)F)Br |
Computed by PubChem (NCBI)